C21H25ClNO3- — CID 53347221
1-(4-ethoxyphenyl)-3-morpholin-4-yl-2-phenylpropan-1-one chloride (PubChem CID 53347221) has the molecular formula C21H25ClNO3- and a molecular weight of 374.89 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-morpholin-4-yl-2-phenylpropan-1-one chloride.
| Compound Name | 1-(4-ethoxyphenyl)-3-morpholin-4-yl-2-phenylpropan-1-one chloride |
|---|---|
| PubChem CID | 53347221 |
| Molecular Formula | C21H25ClNO3- |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-morpholin-4-yl-2-phenylpropan-1-one chloride |
| SMILES | CCOc1ccc(C(=O)C(CN2CCOCC2)c2ccccc2)cc1.[Cl-] |
| InChI | InChI=1S/C21H25NO3.ClH/c1-2-25-19-10-8-18(9-11-19)21(23)20(17-6-4-3-5-7-17)16-22-12-14-24-15-13-22;/h3-11,20H,2,12-16H2,1H3;1H/p-1 |
| InChIKey | CSPPBRFZXWPNTC-UHFFFAOYSA-M |
| XLogP | 0.39 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |