C19H21NOS — CID 117066200
1,2-diphenyl-3-thiomorpholin-4-ylpropan-1-one (PubChem CID 117066200) has the molecular formula C19H21NOS and a molecular weight of 311.45 g/mol. Its IUPAC name is 1,2-diphenyl-3-thiomorpholin-4-ylpropan-1-one.
| Compound Name | 1,2-diphenyl-3-thiomorpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 117066200 |
| Molecular Formula | C19H21NOS |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 1,2-diphenyl-3-thiomorpholin-4-ylpropan-1-one |
| SMILES | O=C(c1ccccc1)C(CN1CCSCC1)c1ccccc1 |
| InChI | InChI=1S/C19H21NOS/c21-19(17-9-5-2-6-10-17)18(16-7-3-1-4-8-16)15-20-11-13-22-14-12-20/h1-10,18H,11-15H2 |
| InChIKey | OUDTYUYHBKMZIP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |