C16H13Cl2O2P — CID 70016744
1-(2,6-dichlorophenyl)-2-phenyl-4-phosphorosobutan-1-one (PubChem CID 70016744) has the molecular formula C16H13Cl2O2P and a molecular weight of 339.16 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-2-phenyl-4-phosphorosobutan-1-one.
| Compound Name | 1-(2,6-dichlorophenyl)-2-phenyl-4-phosphorosobutan-1-one |
|---|---|
| PubChem CID | 70016744 |
| Molecular Formula | C16H13Cl2O2P |
| Molecular Weight | 339.16 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-2-phenyl-4-phosphorosobutan-1-one |
| SMILES | O=PCCC(C(=O)c1c(Cl)cccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C16H13Cl2O2P/c17-13-7-4-8-14(18)15(13)16(19)12(9-10-21-20)11-5-2-1-3-6-11/h1-8,12H,9-10H2 |
| InChIKey | QMKMJSRQELKSOS-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.16 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|