C11H13Cl2OP — CID 174477057
1-(2,6-dichlorophenyl)-2-phosphanylpentan-1-one (PubChem CID 174477057) has the molecular formula C11H13Cl2OP and a molecular weight of 263.10 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-2-phosphanylpentan-1-one.
| Compound Name | 1-(2,6-dichlorophenyl)-2-phosphanylpentan-1-one |
|---|---|
| PubChem CID | 174477057 |
| Molecular Formula | C11H13Cl2OP |
| Molecular Weight | 263.10 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-2-phosphanylpentan-1-one |
| SMILES | CCCC(P)C(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H13Cl2OP/c1-2-4-9(15)11(14)10-7(12)5-3-6-8(10)13/h3,5-6,9H,2,4,15H2,1H3 |
| InChIKey | UDIYIUGWCAVTAC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.10 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|