C11H14Cl2LiOP — CID 174477056
lithium;1-(2,6-dichlorophenyl)-2-phosphanylpentan-1-one;hydride (PubChem CID 174477056) has the molecular formula C11H14Cl2LiOP and a molecular weight of 271.05 g/mol. Its IUPAC name is lithium;1-(2,6-dichlorophenyl)-2-phosphanylpentan-1-one;hydride.
| Compound Name | lithium;1-(2,6-dichlorophenyl)-2-phosphanylpentan-1-one;hydride |
|---|---|
| PubChem CID | 174477056 |
| Molecular Formula | C11H14Cl2LiOP |
| Molecular Weight | 271.05 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | lithium;1-(2,6-dichlorophenyl)-2-phosphanylpentan-1-one;hydride |
| SMILES | CCCC(P)C(=O)c1c(Cl)cccc1Cl.[H-].[Li+] |
| InChI | InChI=1S/C11H13Cl2OP.Li.H/c1-2-4-9(15)11(14)10-7(12)5-3-6-8(10)13;;/h3,5-6,9H,2,4,15H2,1H3;;/q;+1;-1 |
| InChIKey | UUVSELNVUUHKBE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.05 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|