C16H17O3P — CID 163592575
phenoxyphosphanyl 2,4,6-trimethylbenzoate (PubChem CID 163592575) has the molecular formula C16H17O3P and a molecular weight of 288.28 g/mol. Its IUPAC name is phenoxyphosphanyl 2,4,6-trimethylbenzoate.
| Compound Name | phenoxyphosphanyl 2,4,6-trimethylbenzoate |
|---|---|
| PubChem CID | 163592575 |
| Molecular Formula | C16H17O3P |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | phenoxyphosphanyl 2,4,6-trimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)OPOc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C16H17O3P/c1-11-9-12(2)15(13(3)10-11)16(17)19-20-18-14-7-5-4-6-8-14/h4-10,20H,1-3H3 |
| InChIKey | GQSQUBWSZAMXPS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|