C44H42O2P2 — CID 161445922
diphenylphosphanyl-(2,4,6-trimethylphenyl)methanone (PubChem CID 161445922) has the molecular formula C44H42O2P2 and a molecular weight of 664.77 g/mol. Its IUPAC name is diphenylphosphanyl-(2,4,6-trimethylphenyl)methanone.
| Compound Name | diphenylphosphanyl-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 161445922 |
| Molecular Formula | C44H42O2P2 |
| Molecular Weight | 664.77 g/mol |
| Exact Mass | 664.27 |
| IUPAC Name | diphenylphosphanyl-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)P(c2ccccc2)c2ccccc2)c(C)c1.Cc1cc(C)c(C(=O)P(c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/2C22H21OP/c2*1-16-14-17(2)21(18(3)15-16)22(23)24(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h2*4-15H,1-3H3 |
| InChIKey | VZWSFRSDSFFQPF-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.77 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|