C21H21O4P — CID 172856957
(2,6-dimethoxyphenyl)-diphenylphosphanylmethanone;hydrate (PubChem CID 172856957) has the molecular formula C21H21O4P and a molecular weight of 368.37 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl)-diphenylphosphanylmethanone;hydrate.
| Compound Name | (2,6-dimethoxyphenyl)-diphenylphosphanylmethanone;hydrate |
|---|---|
| PubChem CID | 172856957 |
| Molecular Formula | C21H21O4P |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | (2,6-dimethoxyphenyl)-diphenylphosphanylmethanone;hydrate |
| SMILES | COc1cccc(OC)c1C(=O)P(c1ccccc1)c1ccccc1.O |
| InChI | InChI=1S/C21H19O3P.H2O/c1-23-18-14-9-15-19(24-2)20(18)21(22)25(16-10-5-3-6-11-16)17-12-7-4-8-13-17;/h3-15H,1-2H3;1H2 |
| InChIKey | YHFSXNXWTYVISB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 67.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|