C15H23O3P — CID 154288254
[butyl(ethyl)phosphanyl]-(2,6-dimethoxyphenyl)methanone (PubChem CID 154288254) has the molecular formula C15H23O3P and a molecular weight of 282.32 g/mol. Its IUPAC name is [butyl(ethyl)phosphanyl]-(2,6-dimethoxyphenyl)methanone.
| Compound Name | [butyl(ethyl)phosphanyl]-(2,6-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 154288254 |
| Molecular Formula | C15H23O3P |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | [butyl(ethyl)phosphanyl]-(2,6-dimethoxyphenyl)methanone |
| SMILES | CCCCP(CC)C(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C15H23O3P/c1-5-7-11-19(6-2)15(16)14-12(17-3)9-8-10-13(14)18-4/h8-10H,5-7,11H2,1-4H3 |
| InChIKey | ZFCNWUMEXPBEHE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|