C14H20O3 — CID 102226574
2-(1-butoxyethenyl)-1,3-dimethoxybenzene (PubChem CID 102226574) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is 2-(1-butoxyethenyl)-1,3-dimethoxybenzene.
| Compound Name | 2-(1-butoxyethenyl)-1,3-dimethoxybenzene |
|---|---|
| PubChem CID | 102226574 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 2-(1-butoxyethenyl)-1,3-dimethoxybenzene |
| SMILES | C=C(OCCCC)c1c(OC)cccc1OC |
| InChI | InChI=1S/C14H20O3/c1-5-6-10-17-11(2)14-12(15-3)8-7-9-13(14)16-4/h7-9H,2,5-6,10H2,1,3-4H3 |
| InChIKey | GGRNJAVJRBEZAO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|