C27H28O6P+ — CID 175473426
butyl-(2,6-dimethoxybenzoyl)-oxophosphanium;1,2-diphenylethane-1,2-dione (PubChem CID 175473426) has the molecular formula C27H28O6P+ and a molecular weight of 479.49 g/mol. Its IUPAC name is butyl-(2,6-dimethoxybenzoyl)-oxophosphanium;1,2-diphenylethane-1,2-dione.
| Compound Name | butyl-(2,6-dimethoxybenzoyl)-oxophosphanium;1,2-diphenylethane-1,2-dione |
|---|---|
| PubChem CID | 175473426 |
| Molecular Formula | C27H28O6P+ |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | butyl-(2,6-dimethoxybenzoyl)-oxophosphanium;1,2-diphenylethane-1,2-dione |
| SMILES | CCCC[P+](=O)C(=O)c1c(OC)cccc1OC.O=C(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H10O2.C13H18O4P/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;1-4-5-9-18(15)13(14)12-10(16-2)7-6-8-11(12)17-3/h1-10H;6-8H,4-5,9H2,1-3H3/q;+1 |
| InChIKey | ZWTJKHUDJVYPSA-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|