C24H31O5P — CID 175778969
[(2,6-dimethoxybenzoyl)-octylphosphoryl]-phenylmethanone (PubChem CID 175778969) has the molecular formula C24H31O5P and a molecular weight of 430.48 g/mol. Its IUPAC name is [(2,6-dimethoxybenzoyl)-octylphosphoryl]-phenylmethanone.
| Compound Name | [(2,6-dimethoxybenzoyl)-octylphosphoryl]-phenylmethanone |
|---|---|
| PubChem CID | 175778969 |
| Molecular Formula | C24H31O5P |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | [(2,6-dimethoxybenzoyl)-octylphosphoryl]-phenylmethanone |
| SMILES | CCCCCCCCP(=O)(C(=O)c1ccccc1)C(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C24H31O5P/c1-4-5-6-7-8-12-18-30(27,23(25)19-14-10-9-11-15-19)24(26)22-20(28-2)16-13-17-21(22)29-3/h9-11,13-17H,4-8,12,18H2,1-3H3 |
| InChIKey | MFZWBIQSFYCZHI-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|