C26H35O7P — CID 18783616
[(2,6-dimethoxybenzoyl)-(6-methylheptyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone (PubChem CID 18783616) has the molecular formula C26H35O7P and a molecular weight of 490.53 g/mol. Its IUPAC name is [(2,6-dimethoxybenzoyl)-(6-methylheptyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone.
| Compound Name | [(2,6-dimethoxybenzoyl)-(6-methylheptyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 18783616 |
| Molecular Formula | C26H35O7P |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | [(2,6-dimethoxybenzoyl)-(6-methylheptyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone |
| SMILES | COc1cccc(OC)c1C(=O)P(=O)(CCCCCC(C)C)C(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C26H35O7P/c1-18(2)12-8-7-9-17-34(29,25(27)23-19(30-3)13-10-14-20(23)31-4)26(28)24-21(32-5)15-11-16-22(24)33-6/h10-11,13-16,18H,7-9,12,17H2,1-6H3 |
| InChIKey | XJUKBIGGKWBJBN-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|