C24H31O7P — CID 86171400
[(2-ethoxy-6-methoxybenzoyl)-(2-methylpropyl)phosphoryl]-(2-ethoxy-6-methoxyphenyl)methanone (PubChem CID 86171400) has the molecular formula C24H31O7P and a molecular weight of 462.48 g/mol. Its IUPAC name is [(2-ethoxy-6-methoxybenzoyl)-(2-methylpropyl)phosphoryl]-(2-ethoxy-6-methoxyphenyl)methanone.
| Compound Name | [(2-ethoxy-6-methoxybenzoyl)-(2-methylpropyl)phosphoryl]-(2-ethoxy-6-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 86171400 |
| Molecular Formula | C24H31O7P |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | [(2-ethoxy-6-methoxybenzoyl)-(2-methylpropyl)phosphoryl]-(2-ethoxy-6-methoxyphenyl)methanone |
| SMILES | CCOc1cccc(OC)c1C(=O)P(=O)(CC(C)C)C(=O)c1c(OC)cccc1OCC |
| InChI | InChI=1S/C24H31O7P/c1-7-30-19-13-9-11-17(28-5)21(19)23(25)32(27,15-16(3)4)24(26)22-18(29-6)12-10-14-20(22)31-8-2/h9-14,16H,7-8,15H2,1-6H3 |
| InChIKey | QUIJZXMYNHAKSR-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|