C27H29O8P — CID 70012736
(2,6-diethoxyphenyl)-[phenyl-(2,4,6-trimethoxybenzoyl)phosphoryl]methanone (PubChem CID 70012736) has the molecular formula C27H29O8P and a molecular weight of 512.50 g/mol. Its IUPAC name is (2,6-diethoxyphenyl)-[phenyl-(2,4,6-trimethoxybenzoyl)phosphoryl]methanone.
| Compound Name | (2,6-diethoxyphenyl)-[phenyl-(2,4,6-trimethoxybenzoyl)phosphoryl]methanone |
|---|---|
| PubChem CID | 70012736 |
| Molecular Formula | C27H29O8P |
| Molecular Weight | 512.50 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | (2,6-diethoxyphenyl)-[phenyl-(2,4,6-trimethoxybenzoyl)phosphoryl]methanone |
| SMILES | CCOc1cccc(OCC)c1C(=O)P(=O)(C(=O)c1c(OC)cc(OC)cc1OC)c1ccccc1 |
| InChI | InChI=1S/C27H29O8P/c1-6-34-20-14-11-15-21(35-7-2)24(20)26(28)36(30,19-12-9-8-10-13-19)27(29)25-22(32-4)16-18(31-3)17-23(25)33-5/h8-17H,6-7H2,1-5H3 |
| InChIKey | CMFFXXBJEHZAST-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|