C24H29O8P — CID 22183526
[cyclopentyl-(2,4,6-trimethoxybenzoyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone (PubChem CID 22183526) has the molecular formula C24H29O8P and a molecular weight of 476.46 g/mol. Its IUPAC name is [cyclopentyl-(2,4,6-trimethoxybenzoyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone.
| Compound Name | [cyclopentyl-(2,4,6-trimethoxybenzoyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 22183526 |
| Molecular Formula | C24H29O8P |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | [cyclopentyl-(2,4,6-trimethoxybenzoyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone |
| SMILES | COc1cc(OC)c(C(=O)P(=O)(C(=O)c2c(OC)cccc2OC)C2CCCC2)c(OC)c1 |
| InChI | InChI=1S/C24H29O8P/c1-28-15-13-19(31-4)22(20(14-15)32-5)24(26)33(27,16-9-6-7-10-16)23(25)21-17(29-2)11-8-12-18(21)30-3/h8,11-14,16H,6-7,9-10H2,1-5H3 |
| InChIKey | LBNGIRRQOZMLJL-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|