C19H29O4P — CID 22183998
[tert-butyl(cyclohexyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone (PubChem CID 22183998) has the molecular formula C19H29O4P and a molecular weight of 352.41 g/mol. Its IUPAC name is [tert-butyl(cyclohexyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone.
| Compound Name | [tert-butyl(cyclohexyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 22183998 |
| Molecular Formula | C19H29O4P |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | [tert-butyl(cyclohexyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone |
| SMILES | COc1cccc(OC)c1C(=O)P(=O)(C1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C19H29O4P/c1-19(2,3)24(21,14-10-7-6-8-11-14)18(20)17-15(22-4)12-9-13-16(17)23-5/h9,12-14H,6-8,10-11H2,1-5H3 |
| InChIKey | PJMPKYMVDAWKMG-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|