C14H19NO4 — CID 83216402
N-cyclopentyloxy-2,6-dimethoxybenzamide (PubChem CID 83216402) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is N-cyclopentyloxy-2,6-dimethoxybenzamide.
| Compound Name | N-cyclopentyloxy-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 83216402 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | N-cyclopentyloxy-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)NOC1CCCC1 |
| InChI | InChI=1S/C14H19NO4/c1-17-11-8-5-9-12(18-2)13(11)14(16)15-19-10-6-3-4-7-10/h5,8-10H,3-4,6-7H2,1-2H3,(H,15,16) |
| InChIKey | BBQPGWYHXDETNY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|