C20H26N4O3 — CID 113044384
N-[6-(cycloheptylamino)pyridazin-3-yl]-2,6-dimethoxybenzamide (PubChem CID 113044384) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-[6-(cycloheptylamino)pyridazin-3-yl]-2,6-dimethoxybenzamide.
| Compound Name | N-[6-(cycloheptylamino)pyridazin-3-yl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 113044384 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | N-[6-(cycloheptylamino)pyridazin-3-yl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1ccc(NC2CCCCCC2)nn1 |
| InChI | InChI=1S/C20H26N4O3/c1-26-15-10-7-11-16(27-2)19(15)20(25)22-18-13-12-17(23-24-18)21-14-8-5-3-4-6-9-14/h7,10-14H,3-6,8-9H2,1-2H3,(H,21,23)(H,22,24,25) |
| InChIKey | NYGDQIFHMFGOQJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |