C21H33O4P — CID 22183286
[cyclohexyl(hexyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone (PubChem CID 22183286) has the molecular formula C21H33O4P and a molecular weight of 380.47 g/mol. Its IUPAC name is [cyclohexyl(hexyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone.
| Compound Name | [cyclohexyl(hexyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 22183286 |
| Molecular Formula | C21H33O4P |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | [cyclohexyl(hexyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone |
| SMILES | CCCCCCP(=O)(C(=O)c1c(OC)cccc1OC)C1CCCCC1 |
| InChI | InChI=1S/C21H33O4P/c1-4-5-6-10-16-26(23,17-12-8-7-9-13-17)21(22)20-18(24-2)14-11-15-19(20)25-3/h11,14-15,17H,4-10,12-13,16H2,1-3H3 |
| InChIKey | NPYGVNRMKTUGAV-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|