C44H51O13P — CID 172732172
2-[7-bis(2,6-dimethoxybenzoyl)phosphorylheptyl]-1,3-bis(2,6-dimethoxyphenyl)propane-1,3-dione (PubChem CID 172732172) has the molecular formula C44H51O13P and a molecular weight of 818.85 g/mol. Its IUPAC name is 2-[7-bis(2,6-dimethoxybenzoyl)phosphorylheptyl]-1,3-bis(2,6-dimethoxyphenyl)propane-1,3-dione.
| Compound Name | 2-[7-bis(2,6-dimethoxybenzoyl)phosphorylheptyl]-1,3-bis(2,6-dimethoxyphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 172732172 |
| Molecular Formula | C44H51O13P |
| Molecular Weight | 818.85 g/mol |
| Exact Mass | 818.31 |
| IUPAC Name | 2-[7-bis(2,6-dimethoxybenzoyl)phosphorylheptyl]-1,3-bis(2,6-dimethoxyphenyl)propane-1,3-dione |
| SMILES | COc1cccc(OC)c1C(=O)C(CCCCCCCP(=O)(C(=O)c1c(OC)cccc1OC)C(=O)c1c(OC)cccc1OC)C(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C44H51O13P/c1-50-29-19-14-20-30(51-2)37(29)41(45)28(42(46)38-31(52-3)21-15-22-32(38)53-4)18-12-10-9-11-13-27-58(49,43(47)39-33(54-5)23-16-24-34(39)55-6)44(48)40-35(56-7)25-17-26-36(40)57-8/h14-17,19-26,28H,9-13,18,27H2,1-8H3 |
| InChIKey | HYEHBVNCCQLZJU-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.85 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|