C16H25O4P — CID 22183630
[butyl(propyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone (PubChem CID 22183630) has the molecular formula C16H25O4P and a molecular weight of 312.35 g/mol. Its IUPAC name is [butyl(propyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone.
| Compound Name | [butyl(propyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 22183630 |
| Molecular Formula | C16H25O4P |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | [butyl(propyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone |
| SMILES | CCCCP(=O)(CCC)C(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C16H25O4P/c1-5-7-12-21(18,11-6-2)16(17)15-13(19-3)9-8-10-14(15)20-4/h8-10H,5-7,11-12H2,1-4H3 |
| InChIKey | YSGQMZKEXRIAGS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|