C24H33O4P — CID 175697093
2-[benzyl(butyl)phosphoryl]-1-(2,6-dimethoxyphenyl)pentan-1-one (PubChem CID 175697093) has the molecular formula C24H33O4P and a molecular weight of 416.50 g/mol. Its IUPAC name is 2-[benzyl(butyl)phosphoryl]-1-(2,6-dimethoxyphenyl)pentan-1-one.
| Compound Name | 2-[benzyl(butyl)phosphoryl]-1-(2,6-dimethoxyphenyl)pentan-1-one |
|---|---|
| PubChem CID | 175697093 |
| Molecular Formula | C24H33O4P |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 2-[benzyl(butyl)phosphoryl]-1-(2,6-dimethoxyphenyl)pentan-1-one |
| SMILES | CCCCP(=O)(Cc1ccccc1)C(CCC)C(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C24H33O4P/c1-5-7-17-29(26,18-19-13-9-8-10-14-19)22(12-6-2)24(25)23-20(27-3)15-11-16-21(23)28-4/h8-11,13-16,22H,5-7,12,17-18H2,1-4H3 |
| InChIKey | PDODJFGEJGSOGZ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|