About 2-[butyl-(2,6-dimethoxyphenoxy)phosphoryl]oxy-1,3-dimethoxybenzene
2-[butyl-(2,6-dimethoxyphenoxy)phosphoryl]oxy-1,3-dimethoxybenzene (PubChem CID 91739119) has the molecular formula C20H27O7P
and a molecular weight of 410.40 g/mol. Its IUPAC name is 2-[butyl-(2,6-dimethoxyphenoxy)phosphoryl]oxy-1,3-dimethoxybenzene.
Molecular Properties
| Compound Name | 2-[butyl-(2,6-dimethoxyphenoxy)phosphoryl]oxy-1,3-dimethoxybenzene |
| PubChem CID | 91739119 |
| Molecular Formula | C20H27O7P |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 2-[butyl-(2,6-dimethoxyphenoxy)phosphoryl]oxy-1,3-dimethoxybenzene |
| SMILES | CCCCP(=O)(Oc1c(OC)cccc1OC)Oc1c(OC)cccc1OC |
| InChI | InChI=1S/C20H27O7P/c1-6-7-14-28(21,26-19-15(22-2)10-8-11-16(19)23-3)27-20-17(24-4)12-9-13-18(20)25-5/h8-13H,6-7,14H2,1-5H3 |
| InChIKey | QFUCOOUWHUECJG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[butyl-(2,6-dimethoxyphenoxy)phosphoryl]oxy-1,3-dimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[butyl-(2,6-dimethoxyphenoxy)phosphoryl]oxy-1,3-dimethoxybenzene?
The IUPAC name of 2-[butyl-(2,6-dimethoxyphenoxy)phosphoryl]oxy-1,3-dimethoxybenzene (CID 91739119) is 2-[butyl-(2,6-dimethoxyphenoxy)phosphoryl]oxy-1,3-dimethoxybenzene.
What is the SMILES notation for 2-[butyl-(2,6-dimethoxyphenoxy)phosphoryl]oxy-1,3-dimethoxybenzene?
The canonical SMILES for 2-[butyl-(2,6-dimethoxyphenoxy)phosphoryl]oxy-1,3-dimethoxybenzene is CCCCP(=O)(Oc1c(OC)cccc1OC)Oc1c(OC)cccc1OC.
What is the InChIKey of 2-[butyl-(2,6-dimethoxyphenoxy)phosphoryl]oxy-1,3-dimethoxybenzene?
The InChIKey is QFUCOOUWHUECJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27O7P/c1-6-7-14-28(21,26-19-15(22-2)10-8-11-16(19)23-3)27-20-17(24-4)12-9-13-18(20)25-5/h8-13H,6-7,14H2,1-5H3.
What are the key properties of 2-[butyl-(2,6-dimethoxyphenoxy)phosphoryl]oxy-1,3-dimethoxybenzene?
2-[butyl-(2,6-dimethoxyphenoxy)phosphoryl]oxy-1,3-dimethoxybenzene has a molecular weight of 410.40 g/mol, XLogP of 5.17, 11 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[butyl-(2,6-dimethoxyphenoxy)phosphoryl]oxy-1,3-dimethoxybenzene is sourced from PubChem (CID 91739119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).