C20H27O7P — CID 91739119
2-[butyl-(2,6-dimethoxyphenoxy)phosphoryl]oxy-1,3-dimethoxybenzene (PubChem CID 91739119) has the molecular formula C20H27O7P and a molecular weight of 410.40 g/mol. Its IUPAC name is 2-[butyl-(2,6-dimethoxyphenoxy)phosphoryl]oxy-1,3-dimethoxybenzene.
| Compound Name | 2-[butyl-(2,6-dimethoxyphenoxy)phosphoryl]oxy-1,3-dimethoxybenzene |
|---|---|
| PubChem CID | 91739119 |
| Molecular Formula | C20H27O7P |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 2-[butyl-(2,6-dimethoxyphenoxy)phosphoryl]oxy-1,3-dimethoxybenzene |
| SMILES | CCCCP(=O)(Oc1c(OC)cccc1OC)Oc1c(OC)cccc1OC |
| InChI | InChI=1S/C20H27O7P/c1-6-7-14-28(21,26-19-15(22-2)10-8-11-16(19)23-3)27-20-17(24-4)12-9-13-18(20)25-5/h8-13H,6-7,14H2,1-5H3 |
| InChIKey | QFUCOOUWHUECJG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|