C26H39O5P — CID 151808322
2-[[(2,6-dimethoxyphenyl)methyl-octylphosphoryl]methyl]-1,3-dimethoxybenzene (PubChem CID 151808322) has the molecular formula C26H39O5P and a molecular weight of 462.57 g/mol. Its IUPAC name is 2-[[(2,6-dimethoxyphenyl)methyl-octylphosphoryl]methyl]-1,3-dimethoxybenzene.
| Compound Name | 2-[[(2,6-dimethoxyphenyl)methyl-octylphosphoryl]methyl]-1,3-dimethoxybenzene |
|---|---|
| PubChem CID | 151808322 |
| Molecular Formula | C26H39O5P |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 2-[[(2,6-dimethoxyphenyl)methyl-octylphosphoryl]methyl]-1,3-dimethoxybenzene |
| SMILES | CCCCCCCCP(=O)(Cc1c(OC)cccc1OC)Cc1c(OC)cccc1OC |
| InChI | InChI=1S/C26H39O5P/c1-6-7-8-9-10-11-18-32(27,19-21-23(28-2)14-12-15-24(21)29-3)20-22-25(30-4)16-13-17-26(22)31-5/h12-17H,6-11,18-20H2,1-5H3 |
| InChIKey | SABPMSGHOQZUSM-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|