About 1-dihexylphosphorylhexane;1-dioctylphosphoryloctane
1-dihexylphosphorylhexane;1-dioctylphosphoryloctane (PubChem CID 121237547) has the molecular formula C42H90O2P2
and a molecular weight of 689.13 g/mol. Its IUPAC name is 1-dihexylphosphorylhexane;1-dioctylphosphoryloctane.
Molecular Properties
| Compound Name | 1-dihexylphosphorylhexane;1-dioctylphosphoryloctane |
| PubChem CID | 121237547 |
| Molecular Formula | C42H90O2P2 |
| Molecular Weight | 689.13 g/mol |
| Exact Mass | 688.64 |
| IUPAC Name | 1-dihexylphosphorylhexane;1-dioctylphosphoryloctane |
| SMILES | CCCCCCCCP(=O)(CCCCCCCC)CCCCCCCC.CCCCCCP(=O)(CCCCCC)CCCCCC |
| InChI | InChI=1S/C24H51OP.C18H39OP/c1-4-7-10-13-16-19-22-26(25,23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-4-7-10-13-16-20(19,17-14-11-8-5-2)18-15-12-9-6-3/h4-24H2,1-3H3;4-18H2,1-3H3 |
| InChIKey | XCKPOSFWUCCSSP-UHFFFAOYSA-N |
| XLogP | 16.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 689.13 |
| LogP ≤ 5 | 16.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-dihexylphosphorylhexane;1-dioctylphosphoryloctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-dihexylphosphorylhexane;1-dioctylphosphoryloctane?
The IUPAC name of 1-dihexylphosphorylhexane;1-dioctylphosphoryloctane (CID 121237547) is 1-dihexylphosphorylhexane;1-dioctylphosphoryloctane.
What is the SMILES notation for 1-dihexylphosphorylhexane;1-dioctylphosphoryloctane?
The canonical SMILES for 1-dihexylphosphorylhexane;1-dioctylphosphoryloctane is CCCCCCCCP(=O)(CCCCCCCC)CCCCCCCC.CCCCCCP(=O)(CCCCCC)CCCCCC.
What is the InChIKey of 1-dihexylphosphorylhexane;1-dioctylphosphoryloctane?
The InChIKey is XCKPOSFWUCCSSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H51OP.C18H39OP/c1-4-7-10-13-16-19-22-26(25,23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-4-7-10-13-16-20(19,17-14-11-8-5-2)18-15-12-9-6-3/h4-24H2,1-3H3;4-18H2,1-3H3.
What are the key properties of 1-dihexylphosphorylhexane;1-dioctylphosphoryloctane?
1-dihexylphosphorylhexane;1-dioctylphosphoryloctane has a molecular weight of 689.13 g/mol, XLogP of 16.52, 36 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-dihexylphosphorylhexane;1-dioctylphosphoryloctane is sourced from PubChem (CID 121237547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).