About didecylphosphinic acid;nickel
didecylphosphinic acid;nickel (PubChem CID 87135973) has the molecular formula C20H43NiO2P
and a molecular weight of 405.23 g/mol. Its IUPAC name is didecylphosphinic acid;nickel.
Molecular Properties
| Compound Name | didecylphosphinic acid;nickel |
| PubChem CID | 87135973 |
| Molecular Formula | C20H43NiO2P |
| Molecular Weight | 405.23 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | didecylphosphinic acid;nickel |
| SMILES | CCCCCCCCCCP(=O)(O)CCCCCCCCCC.[Ni] |
| InChI | InChI=1S/C20H43O2P.Ni/c1-3-5-7-9-11-13-15-17-19-23(21,22)20-18-16-14-12-10-8-6-4-2;/h3-20H2,1-2H3,(H,21,22); |
| InChIKey | RWZPZHMFCLYIOG-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.23 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze didecylphosphinic acid;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of didecylphosphinic acid;nickel?
The IUPAC name of didecylphosphinic acid;nickel (CID 87135973) is didecylphosphinic acid;nickel.
What is the SMILES notation for didecylphosphinic acid;nickel?
The canonical SMILES for didecylphosphinic acid;nickel is CCCCCCCCCCP(=O)(O)CCCCCCCCCC.[Ni].
What is the InChIKey of didecylphosphinic acid;nickel?
The InChIKey is RWZPZHMFCLYIOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H43O2P.Ni/c1-3-5-7-9-11-13-15-17-19-23(21,22)20-18-16-14-12-10-8-6-4-2;/h3-20H2,1-2H3,(H,21,22);.
What are the key properties of didecylphosphinic acid;nickel?
didecylphosphinic acid;nickel has a molecular weight of 405.23 g/mol, XLogP of 7.54, 18 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for didecylphosphinic acid;nickel is sourced from PubChem (CID 87135973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).