C22H40O2P2 — CID 23418369
1,3-bis(dibutylphosphoryl)benzene (PubChem CID 23418369) has the molecular formula C22H40O2P2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 1,3-bis(dibutylphosphoryl)benzene.
| Compound Name | 1,3-bis(dibutylphosphoryl)benzene |
|---|---|
| PubChem CID | 23418369 |
| Molecular Formula | C22H40O2P2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | 1,3-bis(dibutylphosphoryl)benzene |
| SMILES | CCCCP(=O)(CCCC)c1cccc(P(=O)(CCCC)CCCC)c1 |
| InChI | InChI=1S/C22H40O2P2/c1-5-9-16-25(23,17-10-6-2)21-14-13-15-22(20-21)26(24,18-11-7-3)19-12-8-4/h13-15,20H,5-12,16-19H2,1-4H3 |
| InChIKey | BYTIPVRQLIDAED-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|