About dipentylphosphorylbenzene;methane;1,3,5-trimethylbenzene
dipentylphosphorylbenzene;methane;1,3,5-trimethylbenzene (PubChem CID 174903379) has the molecular formula C26H43OP
and a molecular weight of 402.60 g/mol. Its IUPAC name is dipentylphosphorylbenzene;methane;1,3,5-trimethylbenzene.
Molecular Properties
| Compound Name | dipentylphosphorylbenzene;methane;1,3,5-trimethylbenzene |
| PubChem CID | 174903379 |
| Molecular Formula | C26H43OP |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | dipentylphosphorylbenzene;methane;1,3,5-trimethylbenzene |
| SMILES | C.CCCCCP(=O)(CCCCC)c1ccccc1.Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C16H27OP.C9H12.CH4/c1-3-5-10-14-18(17,15-11-6-4-2)16-12-8-7-9-13-16;1-7-4-8(2)6-9(3)5-7;/h7-9,12-13H,3-6,10-11,14-15H2,1-2H3;4-6H,1-3H3;1H4 |
| InChIKey | CHMYXPODPIEBBB-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dipentylphosphorylbenzene;methane;1,3,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipentylphosphorylbenzene;methane;1,3,5-trimethylbenzene?
The IUPAC name of dipentylphosphorylbenzene;methane;1,3,5-trimethylbenzene (CID 174903379) is dipentylphosphorylbenzene;methane;1,3,5-trimethylbenzene.
What is the SMILES notation for dipentylphosphorylbenzene;methane;1,3,5-trimethylbenzene?
The canonical SMILES for dipentylphosphorylbenzene;methane;1,3,5-trimethylbenzene is C.CCCCCP(=O)(CCCCC)c1ccccc1.Cc1cc(C)cc(C)c1.
What is the InChIKey of dipentylphosphorylbenzene;methane;1,3,5-trimethylbenzene?
The InChIKey is CHMYXPODPIEBBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27OP.C9H12.CH4/c1-3-5-10-14-18(17,15-11-6-4-2)16-12-8-7-9-13-16;1-7-4-8(2)6-9(3)5-7;/h7-9,12-13H,3-6,10-11,14-15H2,1-2H3;4-6H,1-3H3;1H4.
What are the key properties of dipentylphosphorylbenzene;methane;1,3,5-trimethylbenzene?
dipentylphosphorylbenzene;methane;1,3,5-trimethylbenzene has a molecular weight of 402.60 g/mol, XLogP of 8.30, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dipentylphosphorylbenzene;methane;1,3,5-trimethylbenzene is sourced from PubChem (CID 174903379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).