C20H27OP — CID 175050086
1-[butyl-(3,5-dimethylphenyl)phosphoryl]-3,5-dimethylbenzene (PubChem CID 175050086) has the molecular formula C20H27OP and a molecular weight of 314.41 g/mol. Its IUPAC name is 1-[butyl-(3,5-dimethylphenyl)phosphoryl]-3,5-dimethylbenzene.
| Compound Name | 1-[butyl-(3,5-dimethylphenyl)phosphoryl]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 175050086 |
| Molecular Formula | C20H27OP |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 1-[butyl-(3,5-dimethylphenyl)phosphoryl]-3,5-dimethylbenzene |
| SMILES | CCCCP(=O)(c1cc(C)cc(C)c1)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C20H27OP/c1-6-7-8-22(21,19-11-15(2)9-16(3)12-19)20-13-17(4)10-18(5)14-20/h9-14H,6-8H2,1-5H3 |
| InChIKey | LAOMJPOEMNBJPX-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|