C14H23OP — CID 175057624
1-phosphorosopentane;1,3,5-trimethylbenzene (PubChem CID 175057624) has the molecular formula C14H23OP and a molecular weight of 238.31 g/mol. Its IUPAC name is 1-phosphorosopentane;1,3,5-trimethylbenzene.
| Compound Name | 1-phosphorosopentane;1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 175057624 |
| Molecular Formula | C14H23OP |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 1-phosphorosopentane;1,3,5-trimethylbenzene |
| SMILES | CCCCCP=O.Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C9H12.C5H11OP/c1-7-4-8(2)6-9(3)5-7;1-2-3-4-5-7-6/h4-6H,1-3H3;2-5H2,1H3 |
| InChIKey | VXATZZLECUYUJP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|