C14H23N — CID 171202167
(1R)-1-(3,5-dimethylphenyl)hexan-1-amine (PubChem CID 171202167) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is (1R)-1-(3,5-dimethylphenyl)hexan-1-amine.
| Compound Name | (1R)-1-(3,5-dimethylphenyl)hexan-1-amine |
|---|---|
| PubChem CID | 171202167 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (1R)-1-(3,5-dimethylphenyl)hexan-1-amine |
| SMILES | CCCCC[C@@H](N)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C14H23N/c1-4-5-6-7-14(15)13-9-11(2)8-12(3)10-13/h8-10,14H,4-7,15H2,1-3H3/t14-/m1/s1 |
| InChIKey | GUDUXDIZWQSFMC-CQSZACIVSA-N |
| XLogP | 3.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|