C12H17Cl2N — CID 171222079
(1S)-1-(3,5-dichlorophenyl)hexan-1-amine (PubChem CID 171222079) has the molecular formula C12H17Cl2N and a molecular weight of 246.18 g/mol. Its IUPAC name is (1S)-1-(3,5-dichlorophenyl)hexan-1-amine.
| Compound Name | (1S)-1-(3,5-dichlorophenyl)hexan-1-amine |
|---|---|
| PubChem CID | 171222079 |
| Molecular Formula | C12H17Cl2N |
| Molecular Weight | 246.18 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | (1S)-1-(3,5-dichlorophenyl)hexan-1-amine |
| SMILES | CCCCC[C@H](N)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H17Cl2N/c1-2-3-4-5-12(15)9-6-10(13)8-11(14)7-9/h6-8,12H,2-5,15H2,1H3/t12-/m0/s1 |
| InChIKey | CTDLQLFXTSLGEU-LBPRGKRZSA-N |
| XLogP | 4.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.18 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|