C9H12Cl3NO — CID 171202547
(3R)-3-amino-3-(3,5-dichlorophenyl)propan-1-ol;hydrochloride (PubChem CID 171202547) has the molecular formula C9H12Cl3NO and a molecular weight of 256.56 g/mol. Its IUPAC name is (3R)-3-amino-3-(3,5-dichlorophenyl)propan-1-ol;hydrochloride.
| Compound Name | (3R)-3-amino-3-(3,5-dichlorophenyl)propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171202547 |
| Molecular Formula | C9H12Cl3NO |
| Molecular Weight | 256.56 g/mol |
| Exact Mass | 255.00 |
| IUPAC Name | (3R)-3-amino-3-(3,5-dichlorophenyl)propan-1-ol;hydrochloride |
| SMILES | Cl.N[C@H](CCO)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C9H11Cl2NO.ClH/c10-7-3-6(4-8(11)5-7)9(12)1-2-13;/h3-5,9,13H,1-2,12H2;1H/t9-;/m1./s1 |
| InChIKey | HKIMZPLXFNJOHH-SBSPUUFOSA-N |
| XLogP | 2.80 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.56 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |