C8H8Cl2FN — CID 124707721
(1S)-1-(3,5-dichlorophenyl)-2-fluoroethanamine (PubChem CID 124707721) has the molecular formula C8H8Cl2FN and a molecular weight of 208.06 g/mol. Its IUPAC name is (1S)-1-(3,5-dichlorophenyl)-2-fluoroethanamine.
| Compound Name | (1S)-1-(3,5-dichlorophenyl)-2-fluoroethanamine |
|---|---|
| PubChem CID | 124707721 |
| Molecular Formula | C8H8Cl2FN |
| Molecular Weight | 208.06 g/mol |
| Exact Mass | 207.00 |
| IUPAC Name | (1S)-1-(3,5-dichlorophenyl)-2-fluoroethanamine |
| SMILES | N[C@H](CF)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C8H8Cl2FN/c9-6-1-5(8(12)4-11)2-7(10)3-6/h1-3,8H,4,12H2/t8-/m1/s1 |
| InChIKey | RLTAXKIWMZSNSO-MRVPVSSYSA-N |
| XLogP | 2.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.06 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |