C14H22F2 — CID 144528127
1,3-difluoro-2,5-dimethylbenzene;hexane (PubChem CID 144528127) has the molecular formula C14H22F2 and a molecular weight of 228.33 g/mol. Its IUPAC name is 1,3-difluoro-2,5-dimethylbenzene;hexane.
| Compound Name | 1,3-difluoro-2,5-dimethylbenzene;hexane |
|---|---|
| PubChem CID | 144528127 |
| Molecular Formula | C14H22F2 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 1,3-difluoro-2,5-dimethylbenzene;hexane |
| SMILES | CCCCCC.Cc1cc(F)c(C)c(F)c1 |
| InChI | InChI=1S/C8H8F2.C6H14/c1-5-3-7(9)6(2)8(10)4-5;1-3-5-6-4-2/h3-4H,1-2H3;3-6H2,1-2H3 |
| InChIKey | HCLUKADKWKNDSI-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|