About 1,3-difluoro-2,5-dimethylbenzene;hexane
1,3-difluoro-2,5-dimethylbenzene;hexane (PubChem CID 144528127) has the molecular formula C14H22F2
and a molecular weight of 228.33 g/mol. Its IUPAC name is 1,3-difluoro-2,5-dimethylbenzene;hexane.
Molecular Properties
| Compound Name | 1,3-difluoro-2,5-dimethylbenzene;hexane |
| PubChem CID | 144528127 |
| Molecular Formula | C14H22F2 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 1,3-difluoro-2,5-dimethylbenzene;hexane |
| SMILES | CCCCCC.Cc1cc(F)c(C)c(F)c1 |
| InChI | InChI=1S/C8H8F2.C6H14/c1-5-3-7(9)6(2)8(10)4-5;1-3-5-6-4-2/h3-4H,1-2H3;3-6H2,1-2H3 |
| InChIKey | HCLUKADKWKNDSI-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,3-difluoro-2,5-dimethylbenzene;hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-difluoro-2,5-dimethylbenzene;hexane?
The IUPAC name of 1,3-difluoro-2,5-dimethylbenzene;hexane (CID 144528127) is 1,3-difluoro-2,5-dimethylbenzene;hexane.
What is the SMILES notation for 1,3-difluoro-2,5-dimethylbenzene;hexane?
The canonical SMILES for 1,3-difluoro-2,5-dimethylbenzene;hexane is CCCCCC.Cc1cc(F)c(C)c(F)c1.
What is the InChIKey of 1,3-difluoro-2,5-dimethylbenzene;hexane?
The InChIKey is HCLUKADKWKNDSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F2.C6H14/c1-5-3-7(9)6(2)8(10)4-5;1-3-5-6-4-2/h3-4H,1-2H3;3-6H2,1-2H3.
What are the key properties of 1,3-difluoro-2,5-dimethylbenzene;hexane?
1,3-difluoro-2,5-dimethylbenzene;hexane has a molecular weight of 228.33 g/mol, XLogP of 5.17, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-difluoro-2,5-dimethylbenzene;hexane is sourced from PubChem (CID 144528127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).