C10H13BrF2 — CID 142352464
5-bromo-1,3-difluoro-2-methylbenzene;propane (PubChem CID 142352464) has the molecular formula C10H13BrF2 and a molecular weight of 251.11 g/mol. Its IUPAC name is 5-bromo-1,3-difluoro-2-methylbenzene;propane.
| Compound Name | 5-bromo-1,3-difluoro-2-methylbenzene;propane |
|---|---|
| PubChem CID | 142352464 |
| Molecular Formula | C10H13BrF2 |
| Molecular Weight | 251.11 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 5-bromo-1,3-difluoro-2-methylbenzene;propane |
| SMILES | CCC.Cc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C7H5BrF2.C3H8/c1-4-6(9)2-5(8)3-7(4)10;1-3-2/h2-3H,1H3;3H2,1-2H3 |
| InChIKey | XESLPPCCYUZZAH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.11 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |