C7H5Br2F — CID 56604211
2,5-dibromo-1-fluoro-3-methylbenzene (PubChem CID 56604211) has the molecular formula C7H5Br2F and a molecular weight of 267.92 g/mol. Its IUPAC name is 2,5-dibromo-1-fluoro-3-methylbenzene.
| Compound Name | 2,5-dibromo-1-fluoro-3-methylbenzene |
|---|---|
| PubChem CID | 56604211 |
| Molecular Formula | C7H5Br2F |
| Molecular Weight | 267.92 g/mol |
| Exact Mass | 265.87 |
| IUPAC Name | 2,5-dibromo-1-fluoro-3-methylbenzene |
| SMILES | Cc1cc(Br)cc(F)c1Br |
| InChI | InChI=1S/C7H5Br2F/c1-4-2-5(8)3-6(10)7(4)9/h2-3H,1H3 |
| InChIKey | OFUAPBKAKZQRIS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.92 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|