C13H8Br2F4 — CID 160943095
4-bromo-1,2-difluorobenzene;5-bromo-1,2-difluoro-3-methylbenzene (PubChem CID 160943095) has the molecular formula C13H8Br2F4 and a molecular weight of 400.01 g/mol. Its IUPAC name is 4-bromo-1,2-difluorobenzene;5-bromo-1,2-difluoro-3-methylbenzene.
| Compound Name | 4-bromo-1,2-difluorobenzene;5-bromo-1,2-difluoro-3-methylbenzene |
|---|---|
| PubChem CID | 160943095 |
| Molecular Formula | C13H8Br2F4 |
| Molecular Weight | 400.01 g/mol |
| Exact Mass | 397.89 |
| IUPAC Name | 4-bromo-1,2-difluorobenzene;5-bromo-1,2-difluoro-3-methylbenzene |
| SMILES | Cc1cc(Br)cc(F)c1F.Fc1ccc(Br)cc1F |
| InChI | InChI=1S/C7H5BrF2.C6H3BrF2/c1-4-2-5(8)3-6(9)7(4)10;7-4-1-2-5(8)6(9)3-4/h2-3H,1H3;1-3H |
| InChIKey | SUTNKYBIDWTLJT-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.01 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|