C16H16BrF2N — CID 63448815
4-bromo-N-[1-(3,4-difluorophenyl)ethyl]-2,6-dimethylaniline (PubChem CID 63448815) has the molecular formula C16H16BrF2N and a molecular weight of 340.21 g/mol. Its IUPAC name is 4-bromo-N-[1-(3,4-difluorophenyl)ethyl]-2,6-dimethylaniline.
| Compound Name | 4-bromo-N-[1-(3,4-difluorophenyl)ethyl]-2,6-dimethylaniline |
|---|---|
| PubChem CID | 63448815 |
| Molecular Formula | C16H16BrF2N |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 4-bromo-N-[1-(3,4-difluorophenyl)ethyl]-2,6-dimethylaniline |
| SMILES | Cc1cc(Br)cc(C)c1NC(C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H16BrF2N/c1-9-6-13(17)7-10(2)16(9)20-11(3)12-4-5-14(18)15(19)8-12/h4-8,11,20H,1-3H3 |
| InChIKey | OWNKYLAKDKRGAJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |