C15H12F5N — CID 107643680
2,3,5,6-tetrafluoro-N-[1-(3-fluoro-4-methylphenyl)ethyl]aniline (PubChem CID 107643680) has the molecular formula C15H12F5N and a molecular weight of 301.26 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[1-(3-fluoro-4-methylphenyl)ethyl]aniline.
| Compound Name | 2,3,5,6-tetrafluoro-N-[1-(3-fluoro-4-methylphenyl)ethyl]aniline |
|---|---|
| PubChem CID | 107643680 |
| Molecular Formula | C15H12F5N |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[1-(3-fluoro-4-methylphenyl)ethyl]aniline |
| SMILES | Cc1ccc(C(C)Nc2c(F)c(F)cc(F)c2F)cc1F |
| InChI | InChI=1S/C15H12F5N/c1-7-3-4-9(5-10(7)16)8(2)21-15-13(19)11(17)6-12(18)14(15)20/h3-6,8,21H,1-2H3 |
| InChIKey | DLOVHLSTGVTLLF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|