C14H9ClF5N — CID 107643726
N-[1-(3-chloro-4-fluorophenyl)ethyl]-2,3,5,6-tetrafluoroaniline (PubChem CID 107643726) has the molecular formula C14H9ClF5N and a molecular weight of 321.68 g/mol. Its IUPAC name is N-[1-(3-chloro-4-fluorophenyl)ethyl]-2,3,5,6-tetrafluoroaniline.
| Compound Name | N-[1-(3-chloro-4-fluorophenyl)ethyl]-2,3,5,6-tetrafluoroaniline |
|---|---|
| PubChem CID | 107643726 |
| Molecular Formula | C14H9ClF5N |
| Molecular Weight | 321.68 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | N-[1-(3-chloro-4-fluorophenyl)ethyl]-2,3,5,6-tetrafluoroaniline |
| SMILES | CC(Nc1c(F)c(F)cc(F)c1F)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H9ClF5N/c1-6(7-2-3-9(16)8(15)4-7)21-14-12(19)10(17)5-11(18)13(14)20/h2-6,21H,1H3 |
| InChIKey | URQYBNGBGRQZAM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.68 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|