About 1-bromo-3-chloro-5-methylbenzene;4-bromo-1-fluoro-2-methylbenzene
1-bromo-3-chloro-5-methylbenzene;4-bromo-1-fluoro-2-methylbenzene (PubChem CID 142310411) has the molecular formula C14H12Br2ClF
and a molecular weight of 394.51 g/mol. Its IUPAC name is 1-bromo-3-chloro-5-methylbenzene;4-bromo-1-fluoro-2-methylbenzene.
Molecular Properties
| Compound Name | 1-bromo-3-chloro-5-methylbenzene;4-bromo-1-fluoro-2-methylbenzene |
| PubChem CID | 142310411 |
| Molecular Formula | C14H12Br2ClF |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 391.90 |
| IUPAC Name | 1-bromo-3-chloro-5-methylbenzene;4-bromo-1-fluoro-2-methylbenzene |
| SMILES | Cc1cc(Br)ccc1F.Cc1cc(Cl)cc(Br)c1 |
| InChI | InChI=1S/C7H6BrCl.C7H6BrF/c1-5-2-6(8)4-7(9)3-5;1-5-4-6(8)2-3-7(5)9/h2*2-4H,1H3 |
| InChIKey | WNESIMVEWWRCPB-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-3-chloro-5-methylbenzene;4-bromo-1-fluoro-2-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-chloro-5-methylbenzene;4-bromo-1-fluoro-2-methylbenzene?
The IUPAC name of 1-bromo-3-chloro-5-methylbenzene;4-bromo-1-fluoro-2-methylbenzene (CID 142310411) is 1-bromo-3-chloro-5-methylbenzene;4-bromo-1-fluoro-2-methylbenzene.
What is the SMILES notation for 1-bromo-3-chloro-5-methylbenzene;4-bromo-1-fluoro-2-methylbenzene?
The canonical SMILES for 1-bromo-3-chloro-5-methylbenzene;4-bromo-1-fluoro-2-methylbenzene is Cc1cc(Br)ccc1F.Cc1cc(Cl)cc(Br)c1.
What is the InChIKey of 1-bromo-3-chloro-5-methylbenzene;4-bromo-1-fluoro-2-methylbenzene?
The InChIKey is WNESIMVEWWRCPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrCl.C7H6BrF/c1-5-2-6(8)4-7(9)3-5;1-5-4-6(8)2-3-7(5)9/h2*2-4H,1H3.
What are the key properties of 1-bromo-3-chloro-5-methylbenzene;4-bromo-1-fluoro-2-methylbenzene?
1-bromo-3-chloro-5-methylbenzene;4-bromo-1-fluoro-2-methylbenzene has a molecular weight of 394.51 g/mol, XLogP of 6.31, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-chloro-5-methylbenzene;4-bromo-1-fluoro-2-methylbenzene is sourced from PubChem (CID 142310411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).