C32H28Br2 — CID 122211762
2,7-dibromo-9,10-bis(2,4,6-trimethylphenyl)anthracene (PubChem CID 122211762) has the molecular formula C32H28Br2 and a molecular weight of 572.38 g/mol. Its IUPAC name is 2,7-dibromo-9,10-bis(2,4,6-trimethylphenyl)anthracene.
| Compound Name | 2,7-dibromo-9,10-bis(2,4,6-trimethylphenyl)anthracene |
|---|---|
| PubChem CID | 122211762 |
| Molecular Formula | C32H28Br2 |
| Molecular Weight | 572.38 g/mol |
| Exact Mass | 570.06 |
| IUPAC Name | 2,7-dibromo-9,10-bis(2,4,6-trimethylphenyl)anthracene |
| SMILES | Cc1cc(C)c(-c2c3ccc(Br)cc3c(-c3c(C)cc(C)cc3C)c3cc(Br)ccc23)c(C)c1 |
| InChI | InChI=1S/C32H28Br2/c1-17-11-19(3)29(20(4)12-17)31-25-9-7-23(33)15-27(25)32(28-16-24(34)8-10-26(28)31)30-21(5)13-18(2)14-22(30)6/h7-16H,1-6H3 |
| InChIKey | GMPUUEQGEAUCJP-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.38 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|