C50H40Br4 — CID 10123974
2,8-dibromo-5,6-bis(4-bromo-3,5-dimethylphenyl)-11,12-bis(3,5-dimethylphenyl)tetracene (PubChem CID 10123974) has the molecular formula C50H40Br4 and a molecular weight of 960.49 g/mol. Its IUPAC name is 2,8-dibromo-5,6-bis(4-bromo-3,5-dimethylphenyl)-11,12-bis(3,5-dimethylphenyl)tetracene.
| Compound Name | 2,8-dibromo-5,6-bis(4-bromo-3,5-dimethylphenyl)-11,12-bis(3,5-dimethylphenyl)tetracene |
|---|---|
| PubChem CID | 10123974 |
| Molecular Formula | C50H40Br4 |
| Molecular Weight | 960.49 g/mol |
| Exact Mass | 955.99 |
| IUPAC Name | 2,8-dibromo-5,6-bis(4-bromo-3,5-dimethylphenyl)-11,12-bis(3,5-dimethylphenyl)tetracene |
| SMILES | Cc1cc(C)cc(-c2c3ccc(Br)cc3c(-c3cc(C)c(Br)c(C)c3)c3c(-c4cc(C)c(Br)c(C)c4)c4ccc(Br)cc4c(-c4cc(C)cc(C)c4)c23)c1 |
| InChI | InChI=1S/C50H40Br4/c1-25-13-26(2)16-33(15-25)43-39-11-9-38(52)24-42(39)46(36-21-31(7)50(54)32(8)22-36)48-44(35-19-29(5)49(53)30(6)20-35)40-12-10-37(51)23-41(40)45(47(43)48)34-17-27(3)14-28(4)18-34/h9-24H,1-8H3 |
| InChIKey | AJWIEYKJUZWGHS-UHFFFAOYSA-N |
| XLogP | 17.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 960.49 |
| LogP ≤ 5 | 17.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|