C46H40Br2 — CID 142739228
3,6-dibromo-9,10-bis[4-(4-tert-butylphenyl)phenyl]phenanthrene (PubChem CID 142739228) has the molecular formula C46H40Br2 and a molecular weight of 752.63 g/mol. Its IUPAC name is 3,6-dibromo-9,10-bis[4-(4-tert-butylphenyl)phenyl]phenanthrene.
| Compound Name | 3,6-dibromo-9,10-bis[4-(4-tert-butylphenyl)phenyl]phenanthrene |
|---|---|
| PubChem CID | 142739228 |
| Molecular Formula | C46H40Br2 |
| Molecular Weight | 752.63 g/mol |
| Exact Mass | 750.15 |
| IUPAC Name | 3,6-dibromo-9,10-bis[4-(4-tert-butylphenyl)phenyl]phenanthrene |
| SMILES | CC(C)(C)c1ccc(-c2ccc(-c3c(-c4ccc(-c5ccc(C(C)(C)C)cc5)cc4)c4ccc(Br)cc4c4cc(Br)ccc34)cc2)cc1 |
| InChI | InChI=1S/C46H40Br2/c1-45(2,3)35-19-15-31(16-20-35)29-7-11-33(12-8-29)43-39-25-23-37(47)27-41(39)42-28-38(48)24-26-40(42)44(43)34-13-9-30(10-14-34)32-17-21-36(22-18-32)46(4,5)6/h7-28H,1-6H3 |
| InChIKey | JAEUWRQBGHQOBT-UHFFFAOYSA-N |
| XLogP | 14.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.63 |
| LogP ≤ 5 | 14.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|