C34H33Br — CID 142739231
3-bromo-9,10-bis(4-tert-butylphenyl)phenanthrene (PubChem CID 142739231) has the molecular formula C34H33Br and a molecular weight of 521.54 g/mol. Its IUPAC name is 3-bromo-9,10-bis(4-tert-butylphenyl)phenanthrene.
| Compound Name | 3-bromo-9,10-bis(4-tert-butylphenyl)phenanthrene |
|---|---|
| PubChem CID | 142739231 |
| Molecular Formula | C34H33Br |
| Molecular Weight | 521.54 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 3-bromo-9,10-bis(4-tert-butylphenyl)phenanthrene |
| SMILES | CC(C)(C)c1ccc(-c2c(-c3ccc(C(C)(C)C)cc3)c3ccc(Br)cc3c3ccccc23)cc1 |
| InChI | InChI=1S/C34H33Br/c1-33(2,3)24-15-11-22(12-16-24)31-28-10-8-7-9-27(28)30-21-26(35)19-20-29(30)32(31)23-13-17-25(18-14-23)34(4,5)6/h7-21H,1-6H3 |
| InChIKey | CLRZTIUVDQPAOK-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.54 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|