C82H88N2 — CID 177419978
5-N,5-N,12-N,12-N,6,13-hexakis(4-tert-butylphenyl)naphtho[1,2-b]phenanthrene-5,12-diamine (PubChem CID 177419978) has the molecular formula C82H88N2 and a molecular weight of 1101.62 g/mol. Its IUPAC name is 5-N,5-N,12-N,12-N,6,13-hexakis(4-tert-butylphenyl)naphtho[1,2-b]phenanthrene-5,12-diamine.
| Compound Name | 5-N,5-N,12-N,12-N,6,13-hexakis(4-tert-butylphenyl)naphtho[1,2-b]phenanthrene-5,12-diamine |
|---|---|
| PubChem CID | 177419978 |
| Molecular Formula | C82H88N2 |
| Molecular Weight | 1101.62 g/mol |
| Exact Mass | 1100.69 |
| IUPAC Name | 5-N,5-N,12-N,12-N,6,13-hexakis(4-tert-butylphenyl)naphtho[1,2-b]phenanthrene-5,12-diamine |
| SMILES | CC(C)(C)c1ccc(-c2c(N(c3ccc(C(C)(C)C)cc3)c3ccc(C(C)(C)C)cc3)c3ccccc3c3cc4c(-c5ccc(C(C)(C)C)cc5)c(N(c5ccc(C(C)(C)C)cc5)c5ccc(C(C)(C)C)cc5)c5ccccc5c4cc23)cc1 |
| InChI | InChI=1S/C82H88N2/c1-77(2,3)55-31-27-53(28-32-55)73-71-51-70-66-24-20-22-26-68(66)76(84(63-47-39-59(40-48-63)81(13,14)15)64-49-41-60(42-50-64)82(16,17)18)74(54-29-33-56(34-30-54)78(4,5)6)72(70)52-69(71)65-23-19-21-25-67(65)75(73)83(61-43-35-57(36-44-61)79(7,8)9)62-45-37-58(38-46-62)80(10,11)12/h19-52H,1-18H3 |
| InChIKey | QMRTYHDQCAITTN-UHFFFAOYSA-N |
| XLogP | 24.36 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1101.62 |
| LogP ≤ 5 | 24.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|