C46H42Br2N2 — CID 59180638
9-N,10-N-bis(4-bromophenyl)-9-N,10-N-bis(4-tert-butylphenyl)anthracene-9,10-diamine (PubChem CID 59180638) has the molecular formula C46H42Br2N2 and a molecular weight of 782.66 g/mol. Its IUPAC name is 9-N,10-N-bis(4-bromophenyl)-9-N,10-N-bis(4-tert-butylphenyl)anthracene-9,10-diamine.
| Compound Name | 9-N,10-N-bis(4-bromophenyl)-9-N,10-N-bis(4-tert-butylphenyl)anthracene-9,10-diamine |
|---|---|
| PubChem CID | 59180638 |
| Molecular Formula | C46H42Br2N2 |
| Molecular Weight | 782.66 g/mol |
| Exact Mass | 780.17 |
| IUPAC Name | 9-N,10-N-bis(4-bromophenyl)-9-N,10-N-bis(4-tert-butylphenyl)anthracene-9,10-diamine |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(Br)cc2)c2c3ccccc3c(N(c3ccc(Br)cc3)c3ccc(C(C)(C)C)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C46H42Br2N2/c1-45(2,3)31-15-23-35(24-16-31)49(37-27-19-33(47)20-28-37)43-39-11-7-9-13-41(39)44(42-14-10-8-12-40(42)43)50(38-29-21-34(48)22-30-38)36-25-17-32(18-26-36)46(4,5)6/h7-30H,1-6H3 |
| InChIKey | LYCNJFHXKSEPKD-UHFFFAOYSA-N |
| XLogP | 15.05 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.66 |
| LogP ≤ 5 | 15.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|