C54H58Br2N2 — CID 59372230
9-N,10-N-bis(4-bromophenyl)-2,6-ditert-butyl-9-N,10-N-bis(4-tert-butylphenyl)anthracene-9,10-diamine (PubChem CID 59372230) has the molecular formula C54H58Br2N2 and a molecular weight of 894.88 g/mol. Its IUPAC name is 9-N,10-N-bis(4-bromophenyl)-2,6-ditert-butyl-9-N,10-N-bis(4-tert-butylphenyl)anthracene-9,10-diamine.
| Compound Name | 9-N,10-N-bis(4-bromophenyl)-2,6-ditert-butyl-9-N,10-N-bis(4-tert-butylphenyl)anthracene-9,10-diamine |
|---|---|
| PubChem CID | 59372230 |
| Molecular Formula | C54H58Br2N2 |
| Molecular Weight | 894.88 g/mol |
| Exact Mass | 892.30 |
| IUPAC Name | 9-N,10-N-bis(4-bromophenyl)-2,6-ditert-butyl-9-N,10-N-bis(4-tert-butylphenyl)anthracene-9,10-diamine |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(Br)cc2)c2c3ccc(C(C)(C)C)cc3c(N(c3ccc(Br)cc3)c3ccc(C(C)(C)C)cc3)c3ccc(C(C)(C)C)cc23)cc1 |
| InChI | InChI=1S/C54H58Br2N2/c1-51(2,3)35-13-23-41(24-14-35)57(43-27-19-39(55)20-28-43)49-45-31-17-38(54(10,11)12)34-48(45)50(46-32-18-37(33-47(46)49)53(7,8)9)58(44-29-21-40(56)22-30-44)42-25-15-36(16-26-42)52(4,5)6/h13-34H,1-12H3 |
| InChIKey | MFYYURDOYSLNLM-UHFFFAOYSA-N |
| XLogP | 17.65 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.88 |
| LogP ≤ 5 | 17.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|